C17H34O — CID 170104308
1-[5-(5,5-dimethylhexoxy)pentyl]-1-methylcyclopropane (PubChem CID 170104308) has the molecular formula C17H34O and a molecular weight of 254.46 g/mol. Its IUPAC name is 1-[5-(5,5-dimethylhexoxy)pentyl]-1-methylcyclopropane.
| Compound Name | 1-[5-(5,5-dimethylhexoxy)pentyl]-1-methylcyclopropane |
|---|---|
| PubChem CID | 170104308 |
| Molecular Formula | C17H34O |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.26 |
| IUPAC Name | 1-[5-(5,5-dimethylhexoxy)pentyl]-1-methylcyclopropane |
| SMILES | CC(C)(C)CCCCOCCCCCC1(C)CC1 |
| InChI | InChI=1S/C17H34O/c1-16(2,3)10-7-9-15-18-14-8-5-6-11-17(4)12-13-17/h5-15H2,1-4H3 |
| InChIKey | HOLMEVMPOBJMEU-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|