C22H20N6O — CID 16739102
N-(4-amino-1-phenylpyrazol-3-yl)-4-[(pyridin-4-ylamino)methyl]benzamide (PubChem CID 16739102) has the molecular formula C22H20N6O and a molecular weight of 384.44 g/mol. Its IUPAC name is N-(4-amino-1-phenylpyrazol-3-yl)-4-[(pyridin-4-ylamino)methyl]benzamide.
| Compound Name | N-(4-amino-1-phenylpyrazol-3-yl)-4-[(pyridin-4-ylamino)methyl]benzamide |
|---|---|
| PubChem CID | 16739102 |
| Molecular Formula | C22H20N6O |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N-(4-amino-1-phenylpyrazol-3-yl)-4-[(pyridin-4-ylamino)methyl]benzamide |
| SMILES | Nc1cn(-c2ccccc2)nc1NC(=O)c1ccc(CNc2ccncc2)cc1 |
| InChI | InChI=1S/C22H20N6O/c23-20-15-28(19-4-2-1-3-5-19)27-21(20)26-22(29)17-8-6-16(7-9-17)14-25-18-10-12-24-13-11-18/h1-13,15H,14,23H2,(H,24,25)(H,26,27,29) |
| InChIKey | SIGKQPZCSIITQE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |