C16H15N5O3S — CID 71133855
[4-[(4-amino-1-thiophen-3-ylpyrazol-3-yl)carbamoyl]phenyl]methylcarbamic acid (PubChem CID 71133855) has the molecular formula C16H15N5O3S and a molecular weight of 357.40 g/mol. Its IUPAC name is [4-[(4-amino-1-thiophen-3-ylpyrazol-3-yl)carbamoyl]phenyl]methylcarbamic acid.
| Compound Name | [4-[(4-amino-1-thiophen-3-ylpyrazol-3-yl)carbamoyl]phenyl]methylcarbamic acid |
|---|---|
| PubChem CID | 71133855 |
| Molecular Formula | C16H15N5O3S |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | [4-[(4-amino-1-thiophen-3-ylpyrazol-3-yl)carbamoyl]phenyl]methylcarbamic acid |
| SMILES | Nc1cn(-c2ccsc2)nc1NC(=O)c1ccc(CNC(=O)O)cc1 |
| InChI | InChI=1S/C16H15N5O3S/c17-13-8-21(12-5-6-25-9-12)20-14(13)19-15(22)11-3-1-10(2-4-11)7-18-16(23)24/h1-6,8-9,18H,7,17H2,(H,23,24)(H,19,20,22) |
| InChIKey | OHOZDIBAZMFPAW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |