C20H23N4O4P — CID 25012332
N-(4-amino-1-phenylpyrazol-3-yl)-4-diethoxyphosphorylbenzamide (PubChem CID 25012332) has the molecular formula C20H23N4O4P and a molecular weight of 414.40 g/mol. Its IUPAC name is N-(4-amino-1-phenylpyrazol-3-yl)-4-diethoxyphosphorylbenzamide.
| Compound Name | N-(4-amino-1-phenylpyrazol-3-yl)-4-diethoxyphosphorylbenzamide |
|---|---|
| PubChem CID | 25012332 |
| Molecular Formula | C20H23N4O4P |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | N-(4-amino-1-phenylpyrazol-3-yl)-4-diethoxyphosphorylbenzamide |
| SMILES | CCOP(=O)(OCC)c1ccc(C(=O)Nc2nn(-c3ccccc3)cc2N)cc1 |
| InChI | InChI=1S/C20H23N4O4P/c1-3-27-29(26,28-4-2)17-12-10-15(11-13-17)20(25)22-19-18(21)14-24(23-19)16-8-6-5-7-9-16/h5-14H,3-4,21H2,1-2H3,(H,22,23,25) |
| InChIKey | WMULNNYZIGKXCJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|