C41H44N4O3 — CID 16739367
N-[(1S)-1-[5-hydroxy-3-methyl-1-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]indol-2-yl]ethyl]-2-(2-phenyl-1H-indol-3-yl)acetamide (PubChem CID 16739367) has the molecular formula C41H44N4O3 and a molecular weight of 640.83 g/mol. Its IUPAC name is N-[(1S)-1-[5-hydroxy-3-methyl-1-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]indol-2-yl]ethyl]-2-(2-phenyl-1H-indol-3-yl)acetamide.
| Compound Name | N-[(1S)-1-[5-hydroxy-3-methyl-1-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]indol-2-yl]ethyl]-2-(2-phenyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 16739367 |
| Molecular Formula | C41H44N4O3 |
| Molecular Weight | 640.83 g/mol |
| Exact Mass | 640.34 |
| IUPAC Name | N-[(1S)-1-[5-hydroxy-3-methyl-1-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]indol-2-yl]ethyl]-2-(2-phenyl-1H-indol-3-yl)acetamide |
| SMILES | Cc1c([C@H](C)NC(=O)Cc2c(-c3ccccc3)[nH]c3ccccc23)n(Cc2ccc(OCCN3CCCCC3)cc2)c2ccc(O)cc12 |
| InChI | InChI=1S/C41H44N4O3/c1-28-35-25-32(46)17-20-38(35)45(27-30-15-18-33(19-16-30)48-24-23-44-21-9-4-10-22-44)41(28)29(2)42-39(47)26-36-34-13-7-8-14-37(34)43-40(36)31-11-5-3-6-12-31/h3,5-8,11-20,25,29,43,46H,4,9-10,21-24,26-27H2,1-2H3,(H,42,47)/t29-/m0/s1 |
| InChIKey | GEKOXTKXWRGFMQ-LJAQVGFWSA-N |
| XLogP | 8.14 |
| TPSA | 82.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.83 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|