C65H54N4O2 — CID 167401388
5-tert-butyl-3-(2-tert-butylbut-3-enyl)-1-[4-(4-dibenzofuran-1-yl-6-dibenzofuran-4-yl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]indole (PubChem CID 167401388) has the molecular formula C65H54N4O2 and a molecular weight of 923.17 g/mol. Its IUPAC name is 5-tert-butyl-3-(2-tert-butylbut-3-enyl)-1-[4-(4-dibenzofuran-1-yl-6-dibenzofuran-4-yl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]indole.
| Compound Name | 5-tert-butyl-3-(2-tert-butylbut-3-enyl)-1-[4-(4-dibenzofuran-1-yl-6-dibenzofuran-4-yl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]indole |
|---|---|
| PubChem CID | 167401388 |
| Molecular Formula | C65H54N4O2 |
| Molecular Weight | 923.17 g/mol |
| Exact Mass | 922.42 |
| IUPAC Name | 5-tert-butyl-3-(2-tert-butylbut-3-enyl)-1-[4-(4-dibenzofuran-1-yl-6-dibenzofuran-4-yl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]indole |
| SMILES | C=CC(Cc1cn(-c2c(-c3ccccc3)cc(-c3nc(-c4cccc5c4oc4ccccc45)nc(-c4cccc5oc6ccccc6c45)n3)cc2-c2ccccc2)c2ccc(C(C)(C)C)cc12)C(C)(C)C |
| InChI | InChI=1S/C65H54N4O2/c1-8-44(64(2,3)4)35-43-39-69(54-34-33-45(38-51(43)54)65(5,6)7)59-52(40-21-11-9-12-22-40)36-42(37-53(59)41-23-13-10-14-24-41)61-66-62(49-28-20-32-57-58(49)48-26-16-18-31-56(48)70-57)68-63(67-61)50-29-19-27-47-46-25-15-17-30-55(46)71-60(47)50/h8-34,36-39,44H,1,35H2,2-7H3 |
| InChIKey | HTRDNIDIAFIENC-UHFFFAOYSA-N |
| XLogP | 17.64 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.17 |
| LogP ≤ 5 | 17.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|