C11H13BrN2 — CID 167404788
4-bromo-2-propan-2-yl-4H-pyrido[1,2-a]pyrimidine (PubChem CID 167404788) has the molecular formula C11H13BrN2 and a molecular weight of 253.14 g/mol. Its IUPAC name is 4-bromo-2-propan-2-yl-4H-pyrido[1,2-a]pyrimidine.
| Compound Name | 4-bromo-2-propan-2-yl-4H-pyrido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 167404788 |
| Molecular Formula | C11H13BrN2 |
| Molecular Weight | 253.14 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 4-bromo-2-propan-2-yl-4H-pyrido[1,2-a]pyrimidine |
| SMILES | CC(C)C1=CC(Br)N2C=CC=CC2=N1 |
| InChI | InChI=1S/C11H13BrN2/c1-8(2)9-7-10(12)14-6-4-3-5-11(14)13-9/h3-8,10H,1-2H3 |
| InChIKey | RKVZNIUVEFQFSC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.14 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|