C52H32O — CID 167405866
1,2,4,6,8,9-hexadeuterio-3-[2,3,5,6,7,8-hexadeuterio-4-(10-naphthalen-1-ylanthracen-9-yl)naphthalen-1-yl]-7-phenyldibenzofuran (PubChem CID 167405866) has the molecular formula C52H32O and a molecular weight of 684.90 g/mol. Its IUPAC name is 1,2,4,6,8,9-hexadeuterio-3-[2,3,5,6,7,8-hexadeuterio-4-(10-naphthalen-1-ylanthracen-9-yl)naphthalen-1-yl]-7-phenyldibenzofuran.
| Compound Name | 1,2,4,6,8,9-hexadeuterio-3-[2,3,5,6,7,8-hexadeuterio-4-(10-naphthalen-1-ylanthracen-9-yl)naphthalen-1-yl]-7-phenyldibenzofuran |
|---|---|
| PubChem CID | 167405866 |
| Molecular Formula | C52H32O |
| Molecular Weight | 684.90 g/mol |
| Exact Mass | 684.32 |
| IUPAC Name | 1,2,4,6,8,9-hexadeuterio-3-[2,3,5,6,7,8-hexadeuterio-4-(10-naphthalen-1-ylanthracen-9-yl)naphthalen-1-yl]-7-phenyldibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3c4ccccc4c(-c4cccc5ccccc45)c4ccccc34)c([2H])c([2H])c(-c3c([2H])c([2H])c4c(oc5c([2H])c(-c6ccccc6)c([2H])c([2H])c54)c3[2H])c2c1[2H] |
| InChI | InChI=1S/C52H32O/c1-2-13-33(14-3-1)35-25-27-41-42-28-26-36(32-50(42)53-49(41)31-35)38-29-30-48(40-19-7-6-18-39(38)40)52-46-22-10-8-20-44(46)51(45-21-9-11-23-47(45)52)43-24-12-16-34-15-4-5-17-37(34)43/h1-32H/i6D,7D,18D,19D,25D,26D,27D,28D,29D,30D,31D,32D |
| InChIKey | GKHHAWCCLSCWMR-ZJPXKPKZSA-N |
| XLogP | 14.87 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.90 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|