About 1-(1H-1,2,4-triazol-5-yl)indole
1-(1H-1,2,4-triazol-5-yl)indole (PubChem CID 167408371) has the molecular formula C10H8N4
and a molecular weight of 184.20 g/mol. Its IUPAC name is 1-(1H-1,2,4-triazol-5-yl)indole.
Molecular Properties
| Compound Name | 1-(1H-1,2,4-triazol-5-yl)indole |
| PubChem CID | 167408371 |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 1-(1H-1,2,4-triazol-5-yl)indole |
| SMILES | c1ccc2c(c1)ccn2-c1ncn[nH]1 |
| InChI | InChI=1S/C10H8N4/c1-2-4-9-8(3-1)5-6-14(9)10-11-7-12-13-10/h1-7H,(H,11,12,13) |
| InChIKey | OVYOQLYSLLHPME-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1H-1,2,4-triazol-5-yl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-1,2,4-triazol-5-yl)indole?
The IUPAC name of 1-(1H-1,2,4-triazol-5-yl)indole (CID 167408371) is 1-(1H-1,2,4-triazol-5-yl)indole.
What is the SMILES notation for 1-(1H-1,2,4-triazol-5-yl)indole?
The canonical SMILES for 1-(1H-1,2,4-triazol-5-yl)indole is c1ccc2c(c1)ccn2-c1ncn[nH]1.
What is the InChIKey of 1-(1H-1,2,4-triazol-5-yl)indole?
The InChIKey is OVYOQLYSLLHPME-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4/c1-2-4-9-8(3-1)5-6-14(9)10-11-7-12-13-10/h1-7H,(H,11,12,13).
What are the key properties of 1-(1H-1,2,4-triazol-5-yl)indole?
1-(1H-1,2,4-triazol-5-yl)indole has a molecular weight of 184.20 g/mol, XLogP of 1.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-1,2,4-triazol-5-yl)indole is sourced from PubChem (CID 167408371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).