C10H8N4 — CID 167408371
1-(1H-1,2,4-triazol-5-yl)indole (PubChem CID 167408371) has the molecular formula C10H8N4 and a molecular weight of 184.20 g/mol. Its IUPAC name is 1-(1H-1,2,4-triazol-5-yl)indole.
| Compound Name | 1-(1H-1,2,4-triazol-5-yl)indole |
|---|---|
| PubChem CID | 167408371 |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 1-(1H-1,2,4-triazol-5-yl)indole |
| SMILES | c1ccc2c(c1)ccn2-c1ncn[nH]1 |
| InChI | InChI=1S/C10H8N4/c1-2-4-9-8(3-1)5-6-14(9)10-11-7-12-13-10/h1-7H,(H,11,12,13) |
| InChIKey | OVYOQLYSLLHPME-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |