About 2-indol-1-yl-5-methyl-1,3-thiazole
2-indol-1-yl-5-methyl-1,3-thiazole (PubChem CID 86087512) has the molecular formula C12H10N2S
and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-indol-1-yl-5-methyl-1,3-thiazole.
Molecular Properties
| Compound Name | 2-indol-1-yl-5-methyl-1,3-thiazole |
| PubChem CID | 86087512 |
| Molecular Formula | C12H10N2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 2-indol-1-yl-5-methyl-1,3-thiazole |
| SMILES | Cc1cnc(-n2ccc3ccccc32)s1 |
| InChI | InChI=1S/C12H10N2S/c1-9-8-13-12(15-9)14-7-6-10-4-2-3-5-11(10)14/h2-8H,1H3 |
| InChIKey | NTUAAVWQISVPCF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-indol-1-yl-5-methyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-indol-1-yl-5-methyl-1,3-thiazole?
The IUPAC name of 2-indol-1-yl-5-methyl-1,3-thiazole (CID 86087512) is 2-indol-1-yl-5-methyl-1,3-thiazole.
What is the SMILES notation for 2-indol-1-yl-5-methyl-1,3-thiazole?
The canonical SMILES for 2-indol-1-yl-5-methyl-1,3-thiazole is Cc1cnc(-n2ccc3ccccc32)s1.
What is the InChIKey of 2-indol-1-yl-5-methyl-1,3-thiazole?
The InChIKey is NTUAAVWQISVPCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2S/c1-9-8-13-12(15-9)14-7-6-10-4-2-3-5-11(10)14/h2-8H,1H3.
What are the key properties of 2-indol-1-yl-5-methyl-1,3-thiazole?
2-indol-1-yl-5-methyl-1,3-thiazole has a molecular weight of 214.29 g/mol, XLogP of 3.40, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-indol-1-yl-5-methyl-1,3-thiazole is sourced from PubChem (CID 86087512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).