C13H14N5+ — CID 23371648
4-indol-1-yl-N,5-dimethyl-1,3,5-triazin-5-ium-2-amine (PubChem CID 23371648) has the molecular formula C13H14N5+ and a molecular weight of 240.29 g/mol. Its IUPAC name is 4-indol-1-yl-N,5-dimethyl-1,3,5-triazin-5-ium-2-amine.
| Compound Name | 4-indol-1-yl-N,5-dimethyl-1,3,5-triazin-5-ium-2-amine |
|---|---|
| PubChem CID | 23371648 |
| Molecular Formula | C13H14N5+ |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 4-indol-1-yl-N,5-dimethyl-1,3,5-triazin-5-ium-2-amine |
| SMILES | CNc1nc[n+](C)c(-n2ccc3ccccc32)n1 |
| InChI | InChI=1S/C13H13N5/c1-14-12-15-9-17(2)13(16-12)18-8-7-10-5-3-4-6-11(10)18/h3-9H,1-2H3/p+1 |
| InChIKey | MNWADYOKWXZNOY-UHFFFAOYSA-O |
| XLogP | 1.29 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|