C9H11BrO2S — CID 167408843
CID 167408843 (PubChem CID 167408843) has the molecular formula C9H11BrO2S and a molecular weight of 263.16 g/mol.
| Compound Name | CID 167408843 |
|---|---|
| PubChem CID | 167408843 |
| Molecular Formula | C9H11BrO2S |
| Molecular Weight | 263.16 g/mol |
| Exact Mass | 261.97 |
| IUPAC Name | — |
| SMILES | [CH]S(C)(O)c1cc(Br)ccc1OC |
| InChI | InChI=1S/C9H11BrO2S/c1-12-8-5-4-7(10)6-9(8)13(2,3)11/h2,4-6,11H,1,3H3 |
| InChIKey | AWDISJDYLPEADP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.16 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |