C21H15ClN8O2 — CID 167410071
5-[(2-chloro-4-nitrophenyl)diazenyl]-4-N-phenyl-2-pyridin-4-ylpyrimidine-4,6-diamine (PubChem CID 167410071) has the molecular formula C21H15ClN8O2 and a molecular weight of 446.86 g/mol. Its IUPAC name is 5-[(2-chloro-4-nitrophenyl)diazenyl]-4-N-phenyl-2-pyridin-4-ylpyrimidine-4,6-diamine.
| Compound Name | 5-[(2-chloro-4-nitrophenyl)diazenyl]-4-N-phenyl-2-pyridin-4-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 167410071 |
| Molecular Formula | C21H15ClN8O2 |
| Molecular Weight | 446.86 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 5-[(2-chloro-4-nitrophenyl)diazenyl]-4-N-phenyl-2-pyridin-4-ylpyrimidine-4,6-diamine |
| SMILES | Nc1nc(-c2ccncc2)nc(Nc2ccccc2)c1/N=N/c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C21H15ClN8O2/c22-16-12-15(30(31)32)6-7-17(16)28-29-18-19(23)26-20(13-8-10-24-11-9-13)27-21(18)25-14-4-2-1-3-5-14/h1-12H,(H3,23,25,26,27)/b29-28+ |
| InChIKey | UCWYGIKNOLNWFK-ZQHSETAFSA-N |
| XLogP | 5.84 |
| TPSA | 144.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.86 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|