C9H18N2O4S — CID 16741132
(3S,4S)-3-[[(2S)-2-amino-3-methylbutanoyl]amino]-4-hydroxy-4-sulfanylbutanoic acid (PubChem CID 16741132) has the molecular formula C9H18N2O4S and a molecular weight of 250.32 g/mol. Its IUPAC name is (3S,4S)-3-[[(2S)-2-amino-3-methylbutanoyl]amino]-4-hydroxy-4-sulfanylbutanoic acid.
| Compound Name | (3S,4S)-3-[[(2S)-2-amino-3-methylbutanoyl]amino]-4-hydroxy-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 16741132 |
| Molecular Formula | C9H18N2O4S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (3S,4S)-3-[[(2S)-2-amino-3-methylbutanoyl]amino]-4-hydroxy-4-sulfanylbutanoic acid |
| SMILES | CC(C)[C@H](N)C(=O)N[C@@H](CC(=O)O)[C@@H](O)S |
| InChI | InChI=1S/C9H18N2O4S/c1-4(2)7(10)8(14)11-5(9(15)16)3-6(12)13/h4-5,7,9,15-16H,3,10H2,1-2H3,(H,11,14)(H,12,13)/t5-,7-,9-/m0/s1 |
| InChIKey | VKNAOEVSPVGRPN-GCHGDONOSA-N |
| XLogP | -0.82 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|