C16H32FN3 — CID 167417673
1-[(4-fluoro-1-propan-2-ylpiperidin-4-yl)methyl]-4-propan-2-ylpiperazine (PubChem CID 167417673) has the molecular formula C16H32FN3 and a molecular weight of 285.45 g/mol. Its IUPAC name is 1-[(4-fluoro-1-propan-2-ylpiperidin-4-yl)methyl]-4-propan-2-ylpiperazine.
| Compound Name | 1-[(4-fluoro-1-propan-2-ylpiperidin-4-yl)methyl]-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 167417673 |
| Molecular Formula | C16H32FN3 |
| Molecular Weight | 285.45 g/mol |
| Exact Mass | 285.26 |
| IUPAC Name | 1-[(4-fluoro-1-propan-2-ylpiperidin-4-yl)methyl]-4-propan-2-ylpiperazine |
| SMILES | CC(C)N1CCN(CC2(F)CCN(C(C)C)CC2)CC1 |
| InChI | InChI=1S/C16H32FN3/c1-14(2)19-7-5-16(17,6-8-19)13-18-9-11-20(12-10-18)15(3)4/h14-15H,5-13H2,1-4H3 |
| InChIKey | GRTDQGGAUFKFHK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |