C18H33NO6 — CID 167420757
(Z)-5-methyl-4-oxo-N-[2-[2-[2-(2-propan-2-yloxyethoxy)ethoxy]ethoxy]ethyl]hex-2-enamide (PubChem CID 167420757) has the molecular formula C18H33NO6 and a molecular weight of 359.46 g/mol. Its IUPAC name is (Z)-5-methyl-4-oxo-N-[2-[2-[2-(2-propan-2-yloxyethoxy)ethoxy]ethoxy]ethyl]hex-2-enamide.
| Compound Name | (Z)-5-methyl-4-oxo-N-[2-[2-[2-(2-propan-2-yloxyethoxy)ethoxy]ethoxy]ethyl]hex-2-enamide |
|---|---|
| PubChem CID | 167420757 |
| Molecular Formula | C18H33NO6 |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | (Z)-5-methyl-4-oxo-N-[2-[2-[2-(2-propan-2-yloxyethoxy)ethoxy]ethoxy]ethyl]hex-2-enamide |
| SMILES | CC(C)OCCOCCOCCOCCNC(=O)/C=C\C(=O)C(C)C |
| InChI | InChI=1S/C18H33NO6/c1-15(2)17(20)5-6-18(21)19-7-8-22-9-10-23-11-12-24-13-14-25-16(3)4/h5-6,15-16H,7-14H2,1-4H3,(H,19,21)/b6-5- |
| InChIKey | FBMGXTHJEABCQG-WAYWQWQTSA-N |
| XLogP | 1.36 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|