C29H37NO4 — CID 167424550
(2E,4Z,6E,8E,10E,12E,14E,16E,18E)-20-(4-hydroxypiperidin-1-yl)-4,8,13,17-tetramethyl-20-oxoicosa-2,4,6,8,10,12,14,16,18-nonaenoic acid (PubChem CID 167424550) has the molecular formula C29H37NO4 and a molecular weight of 463.62 g/mol. Its IUPAC name is (2E,4Z,6E,8E,10E,12E,14E,16E,18E)-20-(4-hydroxypiperidin-1-yl)-4,8,13,17-tetramethyl-20-oxoicosa-2,4,6,8,10,12,14,16,18-nonaenoic acid.
| Compound Name | (2E,4Z,6E,8E,10E,12E,14E,16E,18E)-20-(4-hydroxypiperidin-1-yl)-4,8,13,17-tetramethyl-20-oxoicosa-2,4,6,8,10,12,14,16,18-nonaenoic acid |
|---|---|
| PubChem CID | 167424550 |
| Molecular Formula | C29H37NO4 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | (2E,4Z,6E,8E,10E,12E,14E,16E,18E)-20-(4-hydroxypiperidin-1-yl)-4,8,13,17-tetramethyl-20-oxoicosa-2,4,6,8,10,12,14,16,18-nonaenoic acid |
| SMILES | CC(=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C(=O)N1CCC(O)CC1)/C=C/C(=O)O |
| InChI | InChI=1S/C29H37NO4/c1-23(9-5-6-10-24(2)12-8-14-26(4)16-18-29(33)34)11-7-13-25(3)15-17-28(32)30-21-19-27(31)20-22-30/h5-18,27,31H,19-22H2,1-4H3,(H,33,34)/b6-5+,11-7+,12-8+,17-15+,18-16+,23-9+,24-10+,25-13+,26-14- |
| InChIKey | NLQTZWAUAUAVMW-YOLQJLCESA-N |
| XLogP | 5.62 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|