C31H41NO4 — CID 170407426
(2E,4Z,6E,8E,10E,12E,14E,16E,18E)-20-[4-(methoxymethyl)piperidin-1-yl]-4,8,13,17-tetramethyl-20-oxoicosa-2,4,6,8,10,12,14,16,18-nonaenoic acid (PubChem CID 170407426) has the molecular formula C31H41NO4 and a molecular weight of 491.67 g/mol. Its IUPAC name is (2E,4Z,6E,8E,10E,12E,14E,16E,18E)-20-[4-(methoxymethyl)piperidin-1-yl]-4,8,13,17-tetramethyl-20-oxoicosa-2,4,6,8,10,12,14,16,18-nonaenoic acid.
| Compound Name | (2E,4Z,6E,8E,10E,12E,14E,16E,18E)-20-[4-(methoxymethyl)piperidin-1-yl]-4,8,13,17-tetramethyl-20-oxoicosa-2,4,6,8,10,12,14,16,18-nonaenoic acid |
|---|---|
| PubChem CID | 170407426 |
| Molecular Formula | C31H41NO4 |
| Molecular Weight | 491.67 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | (2E,4Z,6E,8E,10E,12E,14E,16E,18E)-20-[4-(methoxymethyl)piperidin-1-yl]-4,8,13,17-tetramethyl-20-oxoicosa-2,4,6,8,10,12,14,16,18-nonaenoic acid |
| SMILES | COCC1CCN(C(=O)/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)\C=C\C(=O)O)CC1 |
| InChI | InChI=1S/C31H41NO4/c1-25(10-6-7-11-26(2)13-9-15-28(4)17-19-31(34)35)12-8-14-27(3)16-18-30(33)32-22-20-29(21-23-32)24-36-5/h6-19,29H,20-24H2,1-5H3,(H,34,35)/b7-6+,12-8+,13-9+,18-16+,19-17+,25-10+,26-11+,27-14+,28-15- |
| InChIKey | WUAQYKUVJSVBMW-PXAFZDJESA-N |
| XLogP | 6.52 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.67 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|