C20H27F3N2O4 — CID 167425123
(1R,2S,3S,6R,7S)-4-[3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-2,6-dimethyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylic acid (PubChem CID 167425123) has the molecular formula C20H27F3N2O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is (1R,2S,3S,6R,7S)-4-[3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-2,6-dimethyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylic acid.
| Compound Name | (1R,2S,3S,6R,7S)-4-[3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-2,6-dimethyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylic acid |
|---|---|
| PubChem CID | 167425123 |
| Molecular Formula | C20H27F3N2O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | (1R,2S,3S,6R,7S)-4-[3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-2,6-dimethyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylic acid |
| SMILES | CC(C)(C)C(NC(=O)C(F)(F)F)C(=O)N1C[C@]2(C)[C@@H]3C=C[C@@H](C3)[C@]2(C)[C@H]1C(=O)O |
| InChI | InChI=1S/C20H27F3N2O4/c1-17(2,3)12(24-16(29)20(21,22)23)14(26)25-9-18(4)10-6-7-11(8-10)19(18,5)13(25)15(27)28/h6-7,10-13H,8-9H2,1-5H3,(H,24,29)(H,27,28)/t10-,11+,12?,13-,18-,19-/m1/s1 |
| InChIKey | QPMHADJAHKONGW-XIVDCBJWSA-N |
| XLogP | 2.59 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|