C24H37F3N4O4 — CID 170203721
(1S,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-5,6,6-trimethyl-N-[2-methyl-1-(prop-2-enoylamino)propyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 170203721) has the molecular formula C24H37F3N4O4 and a molecular weight of 502.58 g/mol. Its IUPAC name is (1S,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-5,6,6-trimethyl-N-[2-methyl-1-(prop-2-enoylamino)propyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1S,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-5,6,6-trimethyl-N-[2-methyl-1-(prop-2-enoylamino)propyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 170203721 |
| Molecular Formula | C24H37F3N4O4 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | (1S,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-5,6,6-trimethyl-N-[2-methyl-1-(prop-2-enoylamino)propyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | C=CC(=O)NC(NC(=O)[C@@H]1[C@H]2C(C)(C)[C@@]2(C)CN1C(=O)[C@@H](NC(=O)C(F)(F)F)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C24H37F3N4O4/c1-10-13(32)28-17(12(2)3)30-18(33)14-15-22(7,8)23(15,9)11-31(14)19(34)16(21(4,5)6)29-20(35)24(25,26)27/h10,12,14-17H,1,11H2,2-9H3,(H,28,32)(H,29,35)(H,30,33)/t14-,15-,16+,17?,23-/m0/s1 |
| InChIKey | BCQCMGJXALZYDV-KWWHXMFRSA-N |
| XLogP | 2.35 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|