C26H27F3N6O3 — CID 174283346
(2S,3S)-N-[cyano(2,6-naphthyridin-4-yl)methyl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3-ethenyl-4-methylidenepyrrolidine-2-carboxamide (PubChem CID 174283346) has the molecular formula C26H27F3N6O3 and a molecular weight of 528.54 g/mol. Its IUPAC name is (2S,3S)-N-[cyano(2,6-naphthyridin-4-yl)methyl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3-ethenyl-4-methylidenepyrrolidine-2-carboxamide.
| Compound Name | (2S,3S)-N-[cyano(2,6-naphthyridin-4-yl)methyl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3-ethenyl-4-methylidenepyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 174283346 |
| Molecular Formula | C26H27F3N6O3 |
| Molecular Weight | 528.54 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | (2S,3S)-N-[cyano(2,6-naphthyridin-4-yl)methyl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3-ethenyl-4-methylidenepyrrolidine-2-carboxamide |
| SMILES | C=C[C@H]1C(=C)CN(C(=O)[C@@H](NC(=O)C(F)(F)F)C(C)(C)C)[C@@H]1C(=O)NC(C#N)c1cncc2ccncc12 |
| InChI | InChI=1S/C26H27F3N6O3/c1-6-16-14(2)13-35(23(37)21(25(3,4)5)34-24(38)26(27,28)29)20(16)22(36)33-19(9-30)18-12-32-10-15-7-8-31-11-17(15)18/h6-8,10-12,16,19-21H,1-2,13H2,3-5H3,(H,33,36)(H,34,38)/t16-,19?,20-,21+/m0/s1 |
| InChIKey | WVYHFLDTMPNHKV-BRIRTLKKSA-N |
| XLogP | 2.97 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.54 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|