C31H32F3N5O4 — CID 171608692
(2S,3R)-N-[cyano-(5-methoxyisoquinolin-4-yl)methyl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3-phenylpyrrolidine-2-carboxamide (PubChem CID 171608692) has the molecular formula C31H32F3N5O4 and a molecular weight of 595.62 g/mol. Its IUPAC name is (2S,3R)-N-[cyano-(5-methoxyisoquinolin-4-yl)methyl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3-phenylpyrrolidine-2-carboxamide.
| Compound Name | (2S,3R)-N-[cyano-(5-methoxyisoquinolin-4-yl)methyl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3-phenylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 171608692 |
| Molecular Formula | C31H32F3N5O4 |
| Molecular Weight | 595.62 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | (2S,3R)-N-[cyano-(5-methoxyisoquinolin-4-yl)methyl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3-phenylpyrrolidine-2-carboxamide |
| SMILES | COc1cccc2cncc(C(C#N)NC(=O)[C@@H]3[C@@H](c4ccccc4)CCN3C(=O)[C@@H](NC(=O)C(F)(F)F)C(C)(C)C)c12 |
| InChI | InChI=1S/C31H32F3N5O4/c1-30(2,3)26(38-29(42)31(32,33)34)28(41)39-14-13-20(18-9-6-5-7-10-18)25(39)27(40)37-22(15-35)21-17-36-16-19-11-8-12-23(43-4)24(19)21/h5-12,16-17,20,22,25-26H,13-14H2,1-4H3,(H,37,40)(H,38,42)/t20-,22?,25+,26-/m1/s1 |
| InChIKey | UASLGICSOZGQTR-MAYUIQRESA-N |
| XLogP | 4.40 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.62 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |