C26H31F3N6O3 — CID 174284805
(2S,3R)-N-[cyano(1,7-naphthyridin-5-yl)methyl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3-propan-2-ylpyrrolidine-2-carboxamide (PubChem CID 174284805) has the molecular formula C26H31F3N6O3 and a molecular weight of 532.57 g/mol. Its IUPAC name is (2S,3R)-N-[cyano(1,7-naphthyridin-5-yl)methyl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3-propan-2-ylpyrrolidine-2-carboxamide.
| Compound Name | (2S,3R)-N-[cyano(1,7-naphthyridin-5-yl)methyl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3-propan-2-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 174284805 |
| Molecular Formula | C26H31F3N6O3 |
| Molecular Weight | 532.57 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | (2S,3R)-N-[cyano(1,7-naphthyridin-5-yl)methyl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3-propan-2-ylpyrrolidine-2-carboxamide |
| SMILES | CC(C)[C@H]1CCN(C(=O)[C@@H](NC(=O)C(F)(F)F)C(C)(C)C)[C@@H]1C(=O)NC(C#N)c1cncc2ncccc12 |
| InChI | InChI=1S/C26H31F3N6O3/c1-14(2)15-8-10-35(23(37)21(25(3,4)5)34-24(38)26(27,28)29)20(15)22(36)33-18(11-30)17-12-31-13-19-16(17)7-6-9-32-19/h6-7,9,12-15,18,20-21H,8,10H2,1-5H3,(H,33,36)(H,34,38)/t15-,18?,20+,21-/m1/s1 |
| InChIKey | VGUKKICNBWSUDV-WMKRRTRCSA-N |
| XLogP | 3.28 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |