C47H32 — CID 167425220
1,2,3,4,5,6,8-heptadeuterio-7-naphthalen-1-yl-10-phenyl-9-[(4-phenylnaphthalen-1-yl)methyl]anthracene (PubChem CID 167425220) has the molecular formula C47H32 and a molecular weight of 603.82 g/mol. Its IUPAC name is 1,2,3,4,5,6,8-heptadeuterio-7-naphthalen-1-yl-10-phenyl-9-[(4-phenylnaphthalen-1-yl)methyl]anthracene.
| Compound Name | 1,2,3,4,5,6,8-heptadeuterio-7-naphthalen-1-yl-10-phenyl-9-[(4-phenylnaphthalen-1-yl)methyl]anthracene |
|---|---|
| PubChem CID | 167425220 |
| Molecular Formula | C47H32 |
| Molecular Weight | 603.82 g/mol |
| Exact Mass | 603.29 |
| IUPAC Name | 1,2,3,4,5,6,8-heptadeuterio-7-naphthalen-1-yl-10-phenyl-9-[(4-phenylnaphthalen-1-yl)methyl]anthracene |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccccc3)c3c([2H])c([2H])c(-c4cccc5ccccc45)c([2H])c3c(Cc3ccc(-c4ccccc4)c4ccccc34)c2c1[2H] |
| InChI | InChI=1S/C47H32/c1-3-14-32(15-4-1)40-28-26-36(39-21-9-10-22-41(39)40)30-45-42-23-11-12-24-43(42)47(34-17-5-2-6-18-34)44-29-27-35(31-46(44)45)38-25-13-19-33-16-7-8-20-37(33)38/h1-29,31H,30H2/i11D,12D,23D,24D,27D,29D,31D |
| InChIKey | VRTBOBFEIGXKKE-RGIQKRQUSA-N |
| XLogP | 12.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.82 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|