C25H48O3Si — CID 16742606
(E)-6-methyl-1-[(2S,5S,6R)-5-methyl-6-[2-tri(propan-2-yl)silyloxyethyl]oxan-2-yl]hept-3-en-2-one (PubChem CID 16742606) has the molecular formula C25H48O3Si and a molecular weight of 424.74 g/mol. Its IUPAC name is (E)-6-methyl-1-[(2S,5S,6R)-5-methyl-6-[2-tri(propan-2-yl)silyloxyethyl]oxan-2-yl]hept-3-en-2-one.
| Compound Name | (E)-6-methyl-1-[(2S,5S,6R)-5-methyl-6-[2-tri(propan-2-yl)silyloxyethyl]oxan-2-yl]hept-3-en-2-one |
|---|---|
| PubChem CID | 16742606 |
| Molecular Formula | C25H48O3Si |
| Molecular Weight | 424.74 g/mol |
| Exact Mass | 424.34 |
| IUPAC Name | (E)-6-methyl-1-[(2S,5S,6R)-5-methyl-6-[2-tri(propan-2-yl)silyloxyethyl]oxan-2-yl]hept-3-en-2-one |
| SMILES | CC(C)C/C=C/C(=O)C[C@@H]1CC[C@H](C)[C@@H](CCO[Si](C(C)C)(C(C)C)C(C)C)O1 |
| InChI | InChI=1S/C25H48O3Si/c1-18(2)11-10-12-23(26)17-24-14-13-22(9)25(28-24)15-16-27-29(19(3)4,20(5)6)21(7)8/h10,12,18-22,24-25H,11,13-17H2,1-9H3/b12-10+/t22-,24-,25+/m0/s1 |
| InChIKey | PTRWJXBDUJYNBR-DBLMWFLFSA-N |
| XLogP | 7.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.74 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|