C33H62O3Si2 — CID 138980512
1-[(2S,6R)-6-[(E,2S,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethyl-8-tri(propan-2-yl)silyloct-3-en-7-ynyl]oxan-2-yl]propan-2-one (PubChem CID 138980512) has the molecular formula C33H62O3Si2 and a molecular weight of 563.03 g/mol. Its IUPAC name is 1-[(2S,6R)-6-[(E,2S,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethyl-8-tri(propan-2-yl)silyloct-3-en-7-ynyl]oxan-2-yl]propan-2-one.
| Compound Name | 1-[(2S,6R)-6-[(E,2S,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethyl-8-tri(propan-2-yl)silyloct-3-en-7-ynyl]oxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 138980512 |
| Molecular Formula | C33H62O3Si2 |
| Molecular Weight | 563.03 g/mol |
| Exact Mass | 562.42 |
| IUPAC Name | 1-[(2S,6R)-6-[(E,2S,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethyl-8-tri(propan-2-yl)silyloct-3-en-7-ynyl]oxan-2-yl]propan-2-one |
| SMILES | CC(=O)C[C@@H]1CCC[C@H](C[C@H](C)/C=C/[C@H](C)[C@H](C#C[Si](C(C)C)(C(C)C)C(C)C)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C33H62O3Si2/c1-24(2)38(25(3)4,26(5)6)21-20-32(36-37(13,14)33(10,11)12)28(8)19-18-27(7)22-30-16-15-17-31(35-30)23-29(9)34/h18-19,24-28,30-32H,15-17,22-23H2,1-14H3/b19-18+/t27-,28+,30-,31+,32+/m1/s1 |
| InChIKey | AHBOCXCEYOUOPF-UQSYAMFTSA-N |
| XLogP | 9.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.03 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|