C33H68O5Si3 — CID 11354117
1-[(2S,3S,4R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(E,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhex-2-enyl]oxan-2-yl]propan-2-one (PubChem CID 11354117) has the molecular formula C33H68O5Si3 and a molecular weight of 629.16 g/mol. Its IUPAC name is 1-[(2S,3S,4R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(E,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhex-2-enyl]oxan-2-yl]propan-2-one.
| Compound Name | 1-[(2S,3S,4R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(E,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhex-2-enyl]oxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 11354117 |
| Molecular Formula | C33H68O5Si3 |
| Molecular Weight | 629.16 g/mol |
| Exact Mass | 628.44 |
| IUPAC Name | 1-[(2S,3S,4R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(E,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhex-2-enyl]oxan-2-yl]propan-2-one |
| SMILES | CC(=O)C[C@@H]1OC[C@H](C/C=C/[C@@H](C)[C@H](C)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H68O5Si3/c1-24(26(3)36-39(13,14)31(4,5)6)20-19-21-27-23-35-28(22-25(2)34)30(38-41(17,18)33(10,11)12)29(27)37-40(15,16)32(7,8)9/h19-20,24,26-30H,21-23H2,1-18H3/b20-19+/t24-,26+,27+,28+,29-,30+/m1/s1 |
| InChIKey | CISMTJKSFZNQSS-FZEPUUBTSA-N |
| XLogP | 9.75 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.16 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|