C8H17FN2 — CID 167427252
trans-(1S,4S)-2-(2-fluoroethyl)cyclohexane-1,4-diamine (PubChem CID 167427252) has the molecular formula C8H17FN2 and a molecular weight of 160.24 g/mol. Its IUPAC name is trans-(1S,4S)-2-(2-fluoroethyl)cyclohexane-1,4-diamine.
| Compound Name | trans-(1S,4S)-2-(2-fluoroethyl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 167427252 |
| Molecular Formula | C8H17FN2 |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.14 |
| IUPAC Name | trans-(1S,4S)-2-(2-fluoroethyl)cyclohexane-1,4-diamine |
| SMILES | N[C@H]1CC[C@H](N)C(CCF)C1 |
| InChI | InChI=1S/C8H17FN2/c9-4-3-6-5-7(10)1-2-8(6)11/h6-8H,1-5,10-11H2/t6?,7-,8-/m0/s1 |
| InChIKey | ZOIRFRKARIXYNE-ALKRTJFJSA-N |
| XLogP | 0.80 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |