C10H22N4 — CID 91421365
2-N-(4-aminobut-2-enyl)cyclohexane-1,2,4-triamine (PubChem CID 91421365) has the molecular formula C10H22N4 and a molecular weight of 198.31 g/mol. Its IUPAC name is 2-N-(4-aminobut-2-enyl)cyclohexane-1,2,4-triamine.
| Compound Name | 2-N-(4-aminobut-2-enyl)cyclohexane-1,2,4-triamine |
|---|---|
| PubChem CID | 91421365 |
| Molecular Formula | C10H22N4 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | 2-N-(4-aminobut-2-enyl)cyclohexane-1,2,4-triamine |
| SMILES | NCC=CCNC1CC(N)CCC1N |
| InChI | InChI=1S/C10H22N4/c11-5-1-2-6-14-10-7-8(12)3-4-9(10)13/h1-2,8-10,14H,3-7,11-13H2 |
| InChIKey | NZDLEMSMYCIONC-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|