C21H15N2Se+ — CID 167427527
14-methyl-15-phenyl-17-selena-5-aza-14-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaene (PubChem CID 167427527) has the molecular formula C21H15N2Se+ and a molecular weight of 374.33 g/mol. Its IUPAC name is 14-methyl-15-phenyl-17-selena-5-aza-14-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaene.
| Compound Name | 14-methyl-15-phenyl-17-selena-5-aza-14-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaene |
|---|---|
| PubChem CID | 167427527 |
| Molecular Formula | C21H15N2Se+ |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 14-methyl-15-phenyl-17-selena-5-aza-14-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaene |
| SMILES | C[n+]1ccc2c([se]c3c4ccncc4ccc23)c1-c1ccccc1 |
| InChI | InChI=1S/C21H15N2Se/c1-23-12-10-18-17-8-7-15-13-22-11-9-16(15)20(17)24-21(18)19(23)14-5-3-2-4-6-14/h2-13H,1H3/q+1 |
| InChIKey | JAZKATJQCIQENT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|