C21H16NSe2+ — CID 167427603
10-methyl-9-(1-methylnaphthalen-2-yl)-3,7-diselena-10-azoniatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene (PubChem CID 167427603) has the molecular formula C21H16NSe2+ and a molecular weight of 440.29 g/mol. Its IUPAC name is 10-methyl-9-(1-methylnaphthalen-2-yl)-3,7-diselena-10-azoniatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene.
| Compound Name | 10-methyl-9-(1-methylnaphthalen-2-yl)-3,7-diselena-10-azoniatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene |
|---|---|
| PubChem CID | 167427603 |
| Molecular Formula | C21H16NSe2+ |
| Molecular Weight | 440.29 g/mol |
| Exact Mass | 441.96 |
| IUPAC Name | 10-methyl-9-(1-methylnaphthalen-2-yl)-3,7-diselena-10-azoniatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene |
| SMILES | Cc1c(-c2c3[se]c4cc[se]c4c3cc[n+]2C)ccc2ccccc12 |
| InChI | InChI=1S/C21H16NSe2/c1-13-15-6-4-3-5-14(15)7-8-16(13)19-21-17(9-11-22(19)2)20-18(24-21)10-12-23-20/h3-12H,1-2H3/q+1 |
| InChIKey | XLNRAZFDNTYDNM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|