C17H14NSe2+ — CID 167427551
2-methyl-1-(3-methylselenophen-2-yl)-[1]benzoselenolo[2,3-c]pyridin-2-ium (PubChem CID 167427551) has the molecular formula C17H14NSe2+ and a molecular weight of 390.23 g/mol. Its IUPAC name is 2-methyl-1-(3-methylselenophen-2-yl)-[1]benzoselenolo[2,3-c]pyridin-2-ium.
| Compound Name | 2-methyl-1-(3-methylselenophen-2-yl)-[1]benzoselenolo[2,3-c]pyridin-2-ium |
|---|---|
| PubChem CID | 167427551 |
| Molecular Formula | C17H14NSe2+ |
| Molecular Weight | 390.23 g/mol |
| Exact Mass | 391.95 |
| IUPAC Name | 2-methyl-1-(3-methylselenophen-2-yl)-[1]benzoselenolo[2,3-c]pyridin-2-ium |
| SMILES | Cc1cc[se]c1-c1c2[se]c3ccccc3c2cc[n+]1C |
| InChI | InChI=1S/C17H14NSe2/c1-11-8-10-19-16(11)15-17-13(7-9-18(15)2)12-5-3-4-6-14(12)20-17/h3-10H,1-2H3/q+1 |
| InChIKey | RWAHTHZEBMETTO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.23 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|