C18H15N2Se+ — CID 167427594
3-methyl-4-(2-methylphenyl)selenopheno[3,2-f]phthalazin-3-ium (PubChem CID 167427594) has the molecular formula C18H15N2Se+ and a molecular weight of 338.29 g/mol. Its IUPAC name is 3-methyl-4-(2-methylphenyl)selenopheno[3,2-f]phthalazin-3-ium.
| Compound Name | 3-methyl-4-(2-methylphenyl)selenopheno[3,2-f]phthalazin-3-ium |
|---|---|
| PubChem CID | 167427594 |
| Molecular Formula | C18H15N2Se+ |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 3-methyl-4-(2-methylphenyl)selenopheno[3,2-f]phthalazin-3-ium |
| SMILES | Cc1ccccc1-c1c2ccc3[se]ccc3c2cn[n+]1C |
| InChI | InChI=1S/C18H15N2Se/c1-12-5-3-4-6-13(12)18-15-7-8-17-14(9-10-21-17)16(15)11-19-20(18)2/h3-11H,1-2H3/q+1 |
| InChIKey | JENRQIIKWNXRCB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|