C20H23N7 — CID 167429738
4-[5-(2-aminoethyl)pyrimidin-2-yl]-3-[[4-(2-methylpropyl)triazol-1-yl]methyl]benzonitrile (PubChem CID 167429738) has the molecular formula C20H23N7 and a molecular weight of 361.45 g/mol. Its IUPAC name is 4-[5-(2-aminoethyl)pyrimidin-2-yl]-3-[[4-(2-methylpropyl)triazol-1-yl]methyl]benzonitrile.
| Compound Name | 4-[5-(2-aminoethyl)pyrimidin-2-yl]-3-[[4-(2-methylpropyl)triazol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 167429738 |
| Molecular Formula | C20H23N7 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 4-[5-(2-aminoethyl)pyrimidin-2-yl]-3-[[4-(2-methylpropyl)triazol-1-yl]methyl]benzonitrile |
| SMILES | CC(C)Cc1cn(Cc2cc(C#N)ccc2-c2ncc(CCN)cn2)nn1 |
| InChI | InChI=1S/C20H23N7/c1-14(2)7-18-13-27(26-25-18)12-17-8-15(9-22)3-4-19(17)20-23-10-16(5-6-21)11-24-20/h3-4,8,10-11,13-14H,5-7,12,21H2,1-2H3 |
| InChIKey | TZPLVSCTUIBOBP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |