C22H18N6 — CID 167429823
4-[5-(aminomethyl)pyrimidin-2-yl]-3-[(2-phenylimidazol-1-yl)methyl]benzonitrile (PubChem CID 167429823) has the molecular formula C22H18N6 and a molecular weight of 366.43 g/mol. Its IUPAC name is 4-[5-(aminomethyl)pyrimidin-2-yl]-3-[(2-phenylimidazol-1-yl)methyl]benzonitrile.
| Compound Name | 4-[5-(aminomethyl)pyrimidin-2-yl]-3-[(2-phenylimidazol-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 167429823 |
| Molecular Formula | C22H18N6 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 4-[5-(aminomethyl)pyrimidin-2-yl]-3-[(2-phenylimidazol-1-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ncc(CN)cn2)c(Cn2ccnc2-c2ccccc2)c1 |
| InChI | InChI=1S/C22H18N6/c23-11-16-6-7-20(21-26-13-17(12-24)14-27-21)19(10-16)15-28-9-8-25-22(28)18-4-2-1-3-5-18/h1-10,13-14H,12,15,24H2 |
| InChIKey | MFEKFVWDTFRCRQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |