C23H20N6 — CID 167429340
4-[5-(2-aminoethyl)pyrimidin-2-yl]-3-[(2-phenylimidazol-1-yl)methyl]benzonitrile (PubChem CID 167429340) has the molecular formula C23H20N6 and a molecular weight of 380.46 g/mol. Its IUPAC name is 4-[5-(2-aminoethyl)pyrimidin-2-yl]-3-[(2-phenylimidazol-1-yl)methyl]benzonitrile.
| Compound Name | 4-[5-(2-aminoethyl)pyrimidin-2-yl]-3-[(2-phenylimidazol-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 167429340 |
| Molecular Formula | C23H20N6 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 4-[5-(2-aminoethyl)pyrimidin-2-yl]-3-[(2-phenylimidazol-1-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ncc(CCN)cn2)c(Cn2ccnc2-c2ccccc2)c1 |
| InChI | InChI=1S/C23H20N6/c24-9-8-18-14-27-22(28-15-18)21-7-6-17(13-25)12-20(21)16-29-11-10-26-23(29)19-4-2-1-3-5-19/h1-7,10-12,14-15H,8-9,16,24H2 |
| InChIKey | BDEKQNPDMOUTSX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |