C24H21N5 — CID 167429145
4-[6-(2-aminoethyl)-3-pyridinyl]-3-[(4-phenylimidazol-1-yl)methyl]benzonitrile (PubChem CID 167429145) has the molecular formula C24H21N5 and a molecular weight of 379.47 g/mol. Its IUPAC name is 4-[6-(2-aminoethyl)-3-pyridinyl]-3-[(4-phenylimidazol-1-yl)methyl]benzonitrile.
| Compound Name | 4-[6-(2-aminoethyl)-3-pyridinyl]-3-[(4-phenylimidazol-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 167429145 |
| Molecular Formula | C24H21N5 |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 4-[6-(2-aminoethyl)-3-pyridinyl]-3-[(4-phenylimidazol-1-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(CCN)nc2)c(Cn2cnc(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C24H21N5/c25-11-10-22-8-7-20(14-27-22)23-9-6-18(13-26)12-21(23)15-29-16-24(28-17-29)19-4-2-1-3-5-19/h1-9,12,14,16-17H,10-11,15,25H2 |
| InChIKey | PELCZDPYUAKICU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 80.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |