C19H27N5O4 — CID 167430480
1-[(1R,2R)-2-(4-methyl-2-oxopiperazin-1-yl)cyclohexyl]-3-[(4-nitrophenyl)methyl]urea (PubChem CID 167430480) has the molecular formula C19H27N5O4 and a molecular weight of 389.46 g/mol. Its IUPAC name is 1-[(1R,2R)-2-(4-methyl-2-oxopiperazin-1-yl)cyclohexyl]-3-[(4-nitrophenyl)methyl]urea.
| Compound Name | 1-[(1R,2R)-2-(4-methyl-2-oxopiperazin-1-yl)cyclohexyl]-3-[(4-nitrophenyl)methyl]urea |
|---|---|
| PubChem CID | 167430480 |
| Molecular Formula | C19H27N5O4 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 1-[(1R,2R)-2-(4-methyl-2-oxopiperazin-1-yl)cyclohexyl]-3-[(4-nitrophenyl)methyl]urea |
| SMILES | CN1CCN([C@@H]2CCCC[C@H]2NC(=O)NCc2ccc([N+](=O)[O-])cc2)C(=O)C1 |
| InChI | InChI=1S/C19H27N5O4/c1-22-10-11-23(18(25)13-22)17-5-3-2-4-16(17)21-19(26)20-12-14-6-8-15(9-7-14)24(27)28/h6-9,16-17H,2-5,10-13H2,1H3,(H2,20,21,26)/t16-,17-/m1/s1 |
| InChIKey | VFSAWGAVGSZOJI-IAGOWNOFSA-N |
| XLogP | 1.48 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|