C17H26Cl2N4O4S2Si — CID 167432359
(2S,5R)-6-[tert-butyl(dimethyl)silyl]oxy-N'-(2,5-dichlorothiophen-3-yl)sulfonyl-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide (PubChem CID 167432359) has the molecular formula C17H26Cl2N4O4S2Si and a molecular weight of 513.55 g/mol. Its IUPAC name is (2S,5R)-6-[tert-butyl(dimethyl)silyl]oxy-N'-(2,5-dichlorothiophen-3-yl)sulfonyl-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide.
| Compound Name | (2S,5R)-6-[tert-butyl(dimethyl)silyl]oxy-N'-(2,5-dichlorothiophen-3-yl)sulfonyl-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
|---|---|
| PubChem CID | 167432359 |
| Molecular Formula | C17H26Cl2N4O4S2Si |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 512.05 |
| IUPAC Name | (2S,5R)-6-[tert-butyl(dimethyl)silyl]oxy-N'-(2,5-dichlorothiophen-3-yl)sulfonyl-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
| SMILES | CC(C)(C)[Si](C)(C)ON1C(=O)N2C[C@H]1CC[C@H]2/C(N)=N/S(=O)(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C17H26Cl2N4O4S2Si/c1-17(2,3)30(4,5)27-23-10-6-7-11(22(9-10)16(23)24)15(20)21-29(25,26)12-8-13(18)28-14(12)19/h8,10-11H,6-7,9H2,1-5H3,(H2,20,21)/t10-,11+/m1/s1 |
| InChIKey | QXBIQPXTJZLQGP-MNOVXSKESA-N |
| XLogP | 4.31 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|