C11H12Cl2N4O4S2 — CID 177256977
N'-(2,5-dichlorothiophen-3-yl)sulfonyl-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide (PubChem CID 177256977) has the molecular formula C11H12Cl2N4O4S2 and a molecular weight of 399.28 g/mol. Its IUPAC name is N'-(2,5-dichlorothiophen-3-yl)sulfonyl-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide.
| Compound Name | N'-(2,5-dichlorothiophen-3-yl)sulfonyl-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
|---|---|
| PubChem CID | 177256977 |
| Molecular Formula | C11H12Cl2N4O4S2 |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | N'-(2,5-dichlorothiophen-3-yl)sulfonyl-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
| SMILES | N/C(=N\S(=O)(=O)c1cc(Cl)sc1Cl)C1CCC2CN1C(=O)N2O |
| InChI | InChI=1S/C11H12Cl2N4O4S2/c12-8-3-7(9(13)22-8)23(20,21)15-10(14)6-2-1-5-4-16(6)11(18)17(5)19/h3,5-6,19H,1-2,4H2,(H2,14,15) |
| InChIKey | QLXQOLBQHUAFAZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|