C11H14N4O7S3 — CID 171441236
[(2S,5R)-7-oxo-2-[(Z)-N'-thiophen-2-ylsulfonylcarbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 171441236) has the molecular formula C11H14N4O7S3 and a molecular weight of 410.46 g/mol. Its IUPAC name is [(2S,5R)-7-oxo-2-[(Z)-N'-thiophen-2-ylsulfonylcarbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-7-oxo-2-[(Z)-N'-thiophen-2-ylsulfonylcarbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 171441236 |
| Molecular Formula | C11H14N4O7S3 |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | [(2S,5R)-7-oxo-2-[(Z)-N'-thiophen-2-ylsulfonylcarbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | N/C(=N\S(=O)(=O)c1cccs1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C11H14N4O7S3/c12-10(13-24(17,18)9-2-1-5-23-9)8-4-3-7-6-14(8)11(16)15(7)22-25(19,20)21/h1-2,5,7-8H,3-4,6H2,(H2,12,13)(H,19,20,21)/t7-,8+/m1/s1 |
| InChIKey | OTOUIKCBFNLLLY-SFYZADRCSA-N |
| XLogP | -0.20 |
| TPSA | 159.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|