C11H12Cl2N4O7S3 — CID 171441195
[(5R)-2-[(Z)-N'-(2,5-dichlorothiophen-3-yl)sulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 171441195) has the molecular formula C11H12Cl2N4O7S3 and a molecular weight of 479.35 g/mol. Its IUPAC name is [(5R)-2-[(Z)-N'-(2,5-dichlorothiophen-3-yl)sulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(5R)-2-[(Z)-N'-(2,5-dichlorothiophen-3-yl)sulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 171441195 |
| Molecular Formula | C11H12Cl2N4O7S3 |
| Molecular Weight | 479.35 g/mol |
| Exact Mass | 477.92 |
| IUPAC Name | [(5R)-2-[(Z)-N'-(2,5-dichlorothiophen-3-yl)sulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | N/C(=N\S(=O)(=O)c1cc(Cl)sc1Cl)C1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C11H12Cl2N4O7S3/c12-8-3-7(9(13)25-8)26(19,20)15-10(14)6-2-1-5-4-16(6)11(18)17(5)24-27(21,22)23/h3,5-6H,1-2,4H2,(H2,14,15)(H,21,22,23)/t5-,6?/m1/s1 |
| InChIKey | MBAZMINUBFGYRB-LWOQYNTDSA-N |
| XLogP | 1.10 |
| TPSA | 159.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|