C11H5ClF6O — CID 167432461
5-chloro-3,3-bis(trifluoromethyl)-2H-inden-1-one (PubChem CID 167432461) has the molecular formula C11H5ClF6O and a molecular weight of 302.60 g/mol. Its IUPAC name is 5-chloro-3,3-bis(trifluoromethyl)-2H-inden-1-one.
| Compound Name | 5-chloro-3,3-bis(trifluoromethyl)-2H-inden-1-one |
|---|---|
| PubChem CID | 167432461 |
| Molecular Formula | C11H5ClF6O |
| Molecular Weight | 302.60 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 5-chloro-3,3-bis(trifluoromethyl)-2H-inden-1-one |
| SMILES | O=C1CC(C(F)(F)F)(C(F)(F)F)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C11H5ClF6O/c12-5-1-2-6-7(3-5)9(4-8(6)19,10(13,14)15)11(16,17)18/h1-3H,4H2 |
| InChIKey | AEPQACUDOPVEMN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |