C12H13ClO — CID 84621207
6-chloro-3,3-dimethyl-2,4-dihydronaphthalen-1-one (PubChem CID 84621207) has the molecular formula C12H13ClO and a molecular weight of 208.69 g/mol. Its IUPAC name is 6-chloro-3,3-dimethyl-2,4-dihydronaphthalen-1-one.
| Compound Name | 6-chloro-3,3-dimethyl-2,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 84621207 |
| Molecular Formula | C12H13ClO |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 6-chloro-3,3-dimethyl-2,4-dihydronaphthalen-1-one |
| SMILES | CC1(C)CC(=O)c2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C12H13ClO/c1-12(2)6-8-5-9(13)3-4-10(8)11(14)7-12/h3-5H,6-7H2,1-2H3 |
| InChIKey | SHMBLNKQWJXSHK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |