C15H14Cl2O3 — CID 134088126
2-[(2,4-dichlorophenyl)-hydroxymethylidene]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 134088126) has the molecular formula C15H14Cl2O3 and a molecular weight of 313.18 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)-hydroxymethylidene]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[(2,4-dichlorophenyl)-hydroxymethylidene]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 134088126 |
| Molecular Formula | C15H14Cl2O3 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)-hydroxymethylidene]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)C(=C(O)c2ccc(Cl)cc2Cl)C(=O)C1 |
| InChI | InChI=1S/C15H14Cl2O3/c1-15(2)6-11(18)13(12(19)7-15)14(20)9-4-3-8(16)5-10(9)17/h3-5,20H,6-7H2,1-2H3 |
| InChIKey | ZGVYTOYLJUHJHB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|