C18H30O — CID 145183093
ethane;6-ethyl-3,3-dimethyl-2,4-dihydronaphthalen-1-one (PubChem CID 145183093) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is ethane;6-ethyl-3,3-dimethyl-2,4-dihydronaphthalen-1-one.
| Compound Name | ethane;6-ethyl-3,3-dimethyl-2,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 145183093 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | ethane;6-ethyl-3,3-dimethyl-2,4-dihydronaphthalen-1-one |
| SMILES | CC.CC.CCc1ccc2c(c1)CC(C)(C)CC2=O |
| InChI | InChI=1S/C14H18O.2C2H6/c1-4-10-5-6-12-11(7-10)8-14(2,3)9-13(12)15;2*1-2/h5-7H,4,8-9H2,1-3H3;2*1-2H3 |
| InChIKey | DNVRCCFEBQAIFD-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |