C10HF17O — CID 167433161
3,3,4,4-tetrafluoro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclobutene (PubChem CID 167433161) has the molecular formula C10HF17O and a molecular weight of 460.08 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclobutene.
| Compound Name | 3,3,4,4-tetrafluoro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclobutene |
|---|---|
| PubChem CID | 167433161 |
| Molecular Formula | C10HF17O |
| Molecular Weight | 460.08 g/mol |
| Exact Mass | 459.98 |
| IUPAC Name | 3,3,4,4-tetrafluoro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclobutene |
| SMILES | FC(F)(F)C(OC1=C(C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)C1(F)F)C(F)(F)F |
| InChI | InChI=1S/C10HF17O/c11-4(9(22,23)24,10(25,26)27)1-2(6(14,15)5(1,12)13)28-3(7(16,17)18)8(19,20)21/h3H |
| InChIKey | NHQKEBHDEJEULO-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.08 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|