C14H3F25O — CID 15210909
1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(2,2,3,3,4,4,5,5-octafluoropentoxy)-4-(trifluoromethyl)pent-2-ene (PubChem CID 15210909) has the molecular formula C14H3F25O and a molecular weight of 662.13 g/mol. Its IUPAC name is 1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(2,2,3,3,4,4,5,5-octafluoropentoxy)-4-(trifluoromethyl)pent-2-ene.
| Compound Name | 1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(2,2,3,3,4,4,5,5-octafluoropentoxy)-4-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 15210909 |
| Molecular Formula | C14H3F25O |
| Molecular Weight | 662.13 g/mol |
| Exact Mass | 661.98 |
| IUPAC Name | 1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(2,2,3,3,4,4,5,5-octafluoropentoxy)-4-(trifluoromethyl)pent-2-ene |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)COC(=C(C(F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H3F25O/c15-4(16)8(21,22)10(26,27)5(17,18)1-40-3(9(23,24)25)2(6(19,11(28,29)30)12(31,32)33)7(20,13(34,35)36)14(37,38)39/h4H,1H2 |
| InChIKey | NOHTYTPTCONNLH-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.13 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|