C8HF13O — CID 172509424
3,3,4,4-tetrafluoro-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-(trifluoromethyl)cyclobutene (PubChem CID 172509424) has the molecular formula C8HF13O and a molecular weight of 360.07 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-(trifluoromethyl)cyclobutene.
| Compound Name | 3,3,4,4-tetrafluoro-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-(trifluoromethyl)cyclobutene |
|---|---|
| PubChem CID | 172509424 |
| Molecular Formula | C8HF13O |
| Molecular Weight | 360.07 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | 3,3,4,4-tetrafluoro-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-(trifluoromethyl)cyclobutene |
| SMILES | FC(F)(F)C1=C(OC(C(F)(F)F)C(F)(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8HF13O/c9-4(10)1(6(13,14)15)2(5(4,11)12)22-3(7(16,17)18)8(19,20)21/h3H |
| InChIKey | LAVJYVVFMLJCHQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.07 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|