C10H6F14O — CID 170698893
1,1,1,4,4,5,5,5-octafluoro-3-(4,4,4-trifluorobutoxy)-2-(trifluoromethyl)pent-2-ene (PubChem CID 170698893) has the molecular formula C10H6F14O and a molecular weight of 408.13 g/mol. Its IUPAC name is 1,1,1,4,4,5,5,5-octafluoro-3-(4,4,4-trifluorobutoxy)-2-(trifluoromethyl)pent-2-ene.
| Compound Name | 1,1,1,4,4,5,5,5-octafluoro-3-(4,4,4-trifluorobutoxy)-2-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 170698893 |
| Molecular Formula | C10H6F14O |
| Molecular Weight | 408.13 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | 1,1,1,4,4,5,5,5-octafluoro-3-(4,4,4-trifluorobutoxy)-2-(trifluoromethyl)pent-2-ene |
| SMILES | FC(F)(F)CCCOC(=C(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H6F14O/c11-6(12,13)2-1-3-25-5(7(14,15)10(22,23)24)4(8(16,17)18)9(19,20)21/h1-3H2 |
| InChIKey | RGQZFPPPXDDLCO-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.13 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|